C12H16F6O3 — CID 155764699
[5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate (PubChem CID 155764699) has the molecular formula C12H16F6O3 and a molecular weight of 322.25 g/mol. Its IUPAC name is [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 155764699 |
| Molecular Formula | C12H16F6O3 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [5,5-bis(trifluoromethyl)oxolan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C12H16F6O3/c1-4-9(2,3)8(19)20-7-5-6-10(21-7,11(13,14)15)12(16,17)18/h7H,4-6H2,1-3H3 |
| InChIKey | LDOIYIGLOUSVSV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |