C27H28F3O2S+ — CID 155764741
[3-(2,2-dimethylbutanoyloxy)phenyl]-phenyl-[4-(1,1,1-trifluoropropan-2-yl)phenyl]sulfanium (PubChem CID 155764741) has the molecular formula C27H28F3O2S+ and a molecular weight of 473.58 g/mol. Its IUPAC name is [3-(2,2-dimethylbutanoyloxy)phenyl]-phenyl-[4-(1,1,1-trifluoropropan-2-yl)phenyl]sulfanium.
| Compound Name | [3-(2,2-dimethylbutanoyloxy)phenyl]-phenyl-[4-(1,1,1-trifluoropropan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 155764741 |
| Molecular Formula | C27H28F3O2S+ |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [3-(2,2-dimethylbutanoyloxy)phenyl]-phenyl-[4-(1,1,1-trifluoropropan-2-yl)phenyl]sulfanium |
| SMILES | CCC(C)(C)C(=O)Oc1cccc([S+](c2ccccc2)c2ccc(C(C)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H28F3O2S/c1-5-26(3,4)25(31)32-21-10-9-13-24(18-21)33(22-11-7-6-8-12-22)23-16-14-20(15-17-23)19(2)27(28,29)30/h6-19H,5H2,1-4H3/q+1 |
| InChIKey | FYFCTDVEXHRNQN-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|