C10H12F4N2 — CID 155764999
2,3,5,6-tetrafluoro-N-[(2S)-3-methylbutan-2-yl]pyridin-4-amine (PubChem CID 155764999) has the molecular formula C10H12F4N2 and a molecular weight of 236.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(2S)-3-methylbutan-2-yl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(2S)-3-methylbutan-2-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 155764999 |
| Molecular Formula | C10H12F4N2 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(2S)-3-methylbutan-2-yl]pyridin-4-amine |
| SMILES | CC(C)[C@H](C)Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C10H12F4N2/c1-4(2)5(3)15-8-6(11)9(13)16-10(14)7(8)12/h4-5H,1-3H3,(H,15,16)/t5-/m0/s1 |
| InChIKey | SYDQVONYONJYJQ-YFKPBYRVSA-N |
| XLogP | 3.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|