C13H17F3NO5S2- — CID 155765022
[4-(1-propoxypropan-2-yl)phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 155765022) has the molecular formula C13H17F3NO5S2- and a molecular weight of 388.41 g/mol. Its IUPAC name is [4-(1-propoxypropan-2-yl)phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-(1-propoxypropan-2-yl)phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 155765022 |
| Molecular Formula | C13H17F3NO5S2- |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | [4-(1-propoxypropan-2-yl)phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCCOCC(C)c1ccc(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3NO5S2/c1-3-8-22-9-10(2)11-4-6-12(7-5-11)23(18,19)17-24(20,21)13(14,15)16/h4-7,10H,3,8-9H2,1-2H3/q-1 |
| InChIKey | ZMFPNXJRLIBOFK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|