C20H20ClN5O2S — CID 155765110
[4-[3-[2-[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]ethoxy]-1,4-dimethylpyrazol-5-yl]phenyl]methanol (PubChem CID 155765110) has the molecular formula C20H20ClN5O2S and a molecular weight of 429.93 g/mol. Its IUPAC name is [4-[3-[2-[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]ethoxy]-1,4-dimethylpyrazol-5-yl]phenyl]methanol.
| Compound Name | [4-[3-[2-[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]ethoxy]-1,4-dimethylpyrazol-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 155765110 |
| Molecular Formula | C20H20ClN5O2S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [4-[3-[2-[(5-chlorothieno[2,3-d]pyrimidin-4-yl)amino]ethoxy]-1,4-dimethylpyrazol-5-yl]phenyl]methanol |
| SMILES | Cc1c(OCCNc2ncnc3scc(Cl)c23)nn(C)c1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C20H20ClN5O2S/c1-12-17(14-5-3-13(9-27)4-6-14)26(2)25-19(12)28-8-7-22-18-16-15(21)10-29-20(16)24-11-23-18/h3-6,10-11,27H,7-9H2,1-2H3,(H,22,23,24) |
| InChIKey | VBHOEWQDXDRHOC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|