C39H32N4O3 — CID 155765121
5-[(2Z,5Z)-2,5-bis[(2Z)-2-(1-methylbenzo[cd]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 155765121) has the molecular formula C39H32N4O3 and a molecular weight of 604.71 g/mol. Its IUPAC name is 5-[(2Z,5Z)-2,5-bis[(2Z)-2-(1-methylbenzo[cd]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2Z,5Z)-2,5-bis[(2Z)-2-(1-methylbenzo[cd]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 155765121 |
| Molecular Formula | C39H32N4O3 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 5-[(2Z,5Z)-2,5-bis[(2Z)-2-(1-methylbenzo[cd]indol-2-ylidene)ethylidene]cyclopentylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=C2/C(=C\C=c3\c4cccc5cccc(c54)n3C)CC/C2=C/C=c2/c3cccc4cccc(c43)n2C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C39H32N4O3/c1-40-29(27-13-5-9-23-11-7-15-31(40)34(23)27)21-19-25-17-18-26(33(25)36-37(44)42(3)39(46)43(4)38(36)45)20-22-30-28-14-6-10-24-12-8-16-32(35(24)28)41(30)2/h5-16,19-22H,17-18H2,1-4H3/b25-19-,26-20-,29-21-,30-22- |
| InChIKey | MGDONSTVNHLEGP-JWWHYLJESA-N |
| XLogP | 5.67 |
| TPSA | 67.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|