About potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate
potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate (PubChem CID 155766238) has the molecular formula C10H8I3KO5S
and a molecular weight of 660.05 g/mol. Its IUPAC name is potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate.
Molecular Properties
| Compound Name | potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate |
| PubChem CID | 155766238 |
| Molecular Formula | C10H8I3KO5S |
| Molecular Weight | 660.05 g/mol |
| Exact Mass | 659.69 |
| IUPAC Name | potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate |
| SMILES | O=Cc1c(I)cc(I)c(OCCCS(=O)(=O)[O-])c1I.[K+] |
| InChI | InChI=1S/C10H9I3O5S.K/c11-7-4-8(12)10(9(13)6(7)5-14)18-2-1-3-19(15,16)17;/h4-5H,1-3H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | CJMOIJGSFIWULE-UHFFFAOYSA-M |
| XLogP | -0.37 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 660.05 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate?
The IUPAC name of potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate (CID 155766238) is potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate.
What is the SMILES notation for potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate?
The canonical SMILES for potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate is O=Cc1c(I)cc(I)c(OCCCS(=O)(=O)[O-])c1I.[K+].
What is the InChIKey of potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate?
The InChIKey is CJMOIJGSFIWULE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9I3O5S.K/c11-7-4-8(12)10(9(13)6(7)5-14)18-2-1-3-19(15,16)17;/h4-5H,1-3H2,(H,15,16,17);/q;+1/p-1.
What are the key properties of potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate?
potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate has a molecular weight of 660.05 g/mol, XLogP of -0.37, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-(3-formyl-2,4,6-triiodophenoxy)propane-1-sulfonate is sourced from PubChem (CID 155766238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).