About 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine
4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine (PubChem CID 155766247) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine.
Molecular Properties
| Compound Name | 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine |
| PubChem CID | 155766247 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine |
| SMILES | CCC1CC(C)OC(c2ccncc2)O1 |
| InChI | InChI=1S/C12H17NO2/c1-3-11-8-9(2)14-12(15-11)10-4-6-13-7-5-10/h4-7,9,11-12H,3,8H2,1-2H3 |
| InChIKey | IZSNLYYWGCGXIO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine?
The IUPAC name of 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine (CID 155766247) is 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine.
What is the SMILES notation for 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine?
The canonical SMILES for 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine is CCC1CC(C)OC(c2ccncc2)O1.
What is the InChIKey of 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine?
The InChIKey is IZSNLYYWGCGXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-11-8-9(2)14-12(15-11)10-4-6-13-7-5-10/h4-7,9,11-12H,3,8H2,1-2H3.
What are the key properties of 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine?
4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine has a molecular weight of 207.27 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-6-methyl-1,3-dioxan-2-yl)pyridine is sourced from PubChem (CID 155766247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).