About 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten
1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten (PubChem CID 155766256) has the molecular formula C7H3I3W2-2
and a molecular weight of 835.49 g/mol. Its IUPAC name is 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten.
Molecular Properties
| Compound Name | 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten |
| PubChem CID | 155766256 |
| Molecular Formula | C7H3I3W2-2 |
| Molecular Weight | 835.49 g/mol |
| Exact Mass | 835.64 |
| IUPAC Name | 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten |
| SMILES | Cc1c(I)[c-]c(I)[c-]c1I.[W].[W] |
| InChI | InChI=1S/C7H3I3.2W/c1-4-6(9)2-5(8)3-7(4)10;;/h1H3;;/q-2;; |
| InChIKey | AWYMLHTXCZIODV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 835.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten?
The IUPAC name of 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten (CID 155766256) is 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten.
What is the SMILES notation for 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten?
The canonical SMILES for 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten is Cc1c(I)[c-]c(I)[c-]c1I.[W].[W].
What is the InChIKey of 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten?
The InChIKey is AWYMLHTXCZIODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3I3.2W/c1-4-6(9)2-5(8)3-7(4)10;;/h1H3;;/q-2;;.
What are the key properties of 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten?
1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten has a molecular weight of 835.49 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-triiodo-2-methylbenzene-4,6-diide;tungsten is sourced from PubChem (CID 155766256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).