About 3-propan-2-yloxypyrido[3,2-d]triazin-4-one
3-propan-2-yloxypyrido[3,2-d]triazin-4-one (PubChem CID 155766310) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 3-propan-2-yloxypyrido[3,2-d]triazin-4-one.
Molecular Properties
| Compound Name | 3-propan-2-yloxypyrido[3,2-d]triazin-4-one |
| PubChem CID | 155766310 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3-propan-2-yloxypyrido[3,2-d]triazin-4-one |
| SMILES | CC(C)On1nnc2cccnc2c1=O |
| InChI | InChI=1S/C9H10N4O2/c1-6(2)15-13-9(14)8-7(11-12-13)4-3-5-10-8/h3-6H,1-2H3 |
| InChIKey | TXAKXMZMROAOOP-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-propan-2-yloxypyrido[3,2-d]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxypyrido[3,2-d]triazin-4-one?
The IUPAC name of 3-propan-2-yloxypyrido[3,2-d]triazin-4-one (CID 155766310) is 3-propan-2-yloxypyrido[3,2-d]triazin-4-one.
What is the SMILES notation for 3-propan-2-yloxypyrido[3,2-d]triazin-4-one?
The canonical SMILES for 3-propan-2-yloxypyrido[3,2-d]triazin-4-one is CC(C)On1nnc2cccnc2c1=O.
What is the InChIKey of 3-propan-2-yloxypyrido[3,2-d]triazin-4-one?
The InChIKey is TXAKXMZMROAOOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-6(2)15-13-9(14)8-7(11-12-13)4-3-5-10-8/h3-6H,1-2H3.
What are the key properties of 3-propan-2-yloxypyrido[3,2-d]triazin-4-one?
3-propan-2-yloxypyrido[3,2-d]triazin-4-one has a molecular weight of 206.21 g/mol, XLogP of 0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxypyrido[3,2-d]triazin-4-one is sourced from PubChem (CID 155766310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).