About 2-anilinopropanenitrile
2-anilinopropanenitrile (PubChem CID 15576825) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-anilinopropanenitrile.
Molecular Properties
| Compound Name | 2-anilinopropanenitrile |
| PubChem CID | 15576825 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-anilinopropanenitrile |
| SMILES | CC(C#N)Nc1ccccc1 |
| InChI | InChI=1S/C9H10N2/c1-8(7-10)11-9-5-3-2-4-6-9/h2-6,8,11H,1H3 |
| InChIKey | OBJMWYAZGBFFNS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-anilinopropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinopropanenitrile?
The IUPAC name of 2-anilinopropanenitrile (CID 15576825) is 2-anilinopropanenitrile.
What is the SMILES notation for 2-anilinopropanenitrile?
The canonical SMILES for 2-anilinopropanenitrile is CC(C#N)Nc1ccccc1.
What is the InChIKey of 2-anilinopropanenitrile?
The InChIKey is OBJMWYAZGBFFNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-8(7-10)11-9-5-3-2-4-6-9/h2-6,8,11H,1H3.
What are the key properties of 2-anilinopropanenitrile?
2-anilinopropanenitrile has a molecular weight of 146.19 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinopropanenitrile is sourced from PubChem (CID 15576825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).