C20H20F3N3O4 — CID 155769030
[cyclobutanecarbonyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino] cyclobutanecarboxylate (PubChem CID 155769030) has the molecular formula C20H20F3N3O4 and a molecular weight of 423.39 g/mol. Its IUPAC name is [cyclobutanecarbonyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino] cyclobutanecarboxylate.
| Compound Name | [cyclobutanecarbonyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 155769030 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [cyclobutanecarbonyl-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]amino] cyclobutanecarboxylate |
| SMILES | O=C(ON(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)C(=O)C1CCC1)C1CCC1 |
| InChI | InChI=1S/C20H20F3N3O4/c21-20(22,23)19-24-16(25-29-19)13-9-7-12(8-10-13)11-26(17(27)14-3-1-4-14)30-18(28)15-5-2-6-15/h7-10,14-15H,1-6,11H2 |
| InChIKey | FUXYYKMFIYNOJS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|