About 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine
10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine (PubChem CID 155769460) has the molecular formula C36H38BrN
and a molecular weight of 564.61 g/mol. Its IUPAC name is 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine.
Molecular Properties
| Compound Name | 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine |
| PubChem CID | 155769460 |
| Molecular Formula | C36H38BrN |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2c3cc(C(C)(C)C)ccc3c(Br)c3ccc(C(C)(C)C)cc23)cc1 |
| InChI | InChI=1S/C36H38BrN/c1-23-9-15-27(16-10-23)38(28-17-11-24(2)12-18-28)34-31-21-25(35(3,4)5)13-19-29(31)33(37)30-20-14-26(22-32(30)34)36(6,7)8/h9-22H,1-8H3 |
| InChIKey | IEHWATPPFMPOAM-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine?
The IUPAC name of 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine (CID 155769460) is 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine.
What is the SMILES notation for 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine?
The canonical SMILES for 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine is Cc1ccc(N(c2ccc(C)cc2)c2c3cc(C(C)(C)C)ccc3c(Br)c3ccc(C(C)(C)C)cc23)cc1.
What is the InChIKey of 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine?
The InChIKey is IEHWATPPFMPOAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H38BrN/c1-23-9-15-27(16-10-23)38(28-17-11-24(2)12-18-28)34-31-21-25(35(3,4)5)13-19-29(31)33(37)30-20-14-26(22-32(30)34)36(6,7)8/h9-22H,1-8H3.
What are the key properties of 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine?
10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine has a molecular weight of 564.61 g/mol, XLogP of 11.44, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromo-2,7-ditert-butyl-N,N-bis(4-methylphenyl)anthracen-9-amine is sourced from PubChem (CID 155769460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).