About 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane
2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane (PubChem CID 15576973) has the molecular formula C7H10F6
and a molecular weight of 208.14 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane.
Analyze 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane?
The IUPAC name of 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane (CID 15576973) is 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane.
What is the SMILES notation for 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane?
The canonical SMILES for 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane is CCC(C)C(F)(C(F)F)C(F)(F)F.
What is the InChIKey of 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane?
The InChIKey is NNYCMFMXEXKWQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F6/c1-3-4(2)6(10,5(8)9)7(11,12)13/h4-5H,3H2,1-2H3.
What are the key properties of 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane?
2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane has a molecular weight of 208.14 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,1,1,2-tetrafluoro-3-methylpentane is sourced from PubChem (CID 15576973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).