About CID 155769734
CID 155769734 (PubChem CID 155769734) has the molecular formula C38H44F3IrN2O2-
and a molecular weight of 809.99 g/mol.
Molecular Properties
| Compound Name | CID 155769734 |
| PubChem CID | 155769734 |
| Molecular Formula | C38H44F3IrN2O2- |
| Molecular Weight | 809.99 g/mol |
| Exact Mass | 810.30 |
| IUPAC Name | — |
| SMILES | CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1ccc2[c-]c3c(c(C)c2c1)c1ccc(CC(F)(F)F)cc1n1ccnc31.[Ir] |
| InChI | InChI=1S/C23H16F3N2.C15H28O2.Ir/c1-13-3-5-16-11-19-21(14(2)18(16)9-13)17-6-4-15(12-23(24,25)26)10-20(17)28-8-7-27-22(19)28;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h3-10H,12H2,1-2H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-; |
| InChIKey | YWKFUSWVYMZQCF-SWPBDETKSA-N |
| XLogP | 10.96 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 809.99 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 155769734 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155769734?
The IUPAC name of CID 155769734 (CID 155769734) is not available.
What is the SMILES notation for CID 155769734?
The canonical SMILES for CID 155769734 is CCC(C)(CC)C(=O)/C=C(\O)C(C)(CC)CC.Cc1ccc2[c-]c3c(c(C)c2c1)c1ccc(CC(F)(F)F)cc1n1ccnc31.[Ir].
What is the InChIKey of CID 155769734?
The InChIKey is YWKFUSWVYMZQCF-SWPBDETKSA-N. The full InChI is InChI=1S/C23H16F3N2.C15H28O2.Ir/c1-13-3-5-16-11-19-21(14(2)18(16)9-13)17-6-4-15(12-23(24,25)26)10-20(17)28-8-7-27-22(19)28;1-7-14(5,8-2)12(16)11-13(17)15(6,9-3)10-4;/h3-10H,12H2,1-2H3;11,16H,7-10H2,1-6H3;/q-1;;/b;12-11-;.
What are the key properties of CID 155769734?
CID 155769734 has a molecular weight of 809.99 g/mol, XLogP of 10.96, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155769734 is sourced from PubChem (CID 155769734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).