C8H12F6 — CID 15576977
4-ethyl-1,1,1,2,3,3-hexafluorohexane (PubChem CID 15576977) has the molecular formula C8H12F6 and a molecular weight of 222.17 g/mol. Its IUPAC name is 4-ethyl-1,1,1,2,3,3-hexafluorohexane.
| Compound Name | 4-ethyl-1,1,1,2,3,3-hexafluorohexane |
|---|---|
| PubChem CID | 15576977 |
| Molecular Formula | C8H12F6 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 4-ethyl-1,1,1,2,3,3-hexafluorohexane |
| SMILES | CCC(CC)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6/c1-3-5(4-2)7(10,11)6(9)8(12,13)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | UNBZUZJAAAGZQZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |