About CID 155769912
CID 155769912 (PubChem CID 155769912) has the molecular formula C14H20NO3Si
and a molecular weight of 278.40 g/mol.
Molecular Properties
| Compound Name | CID 155769912 |
| PubChem CID | 155769912 |
| Molecular Formula | C14H20NO3Si |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | — |
| SMILES | CCC(C)(C)OC(=O)N(C)c1ccc(OC[Si])cc1 |
| InChI | InChI=1S/C14H20NO3Si/c1-5-14(2,3)18-13(16)15(4)11-6-8-12(9-7-11)17-10-19/h6-9H,5,10H2,1-4H3 |
| InChIKey | UYDJYRJXIIEEKK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155769912 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155769912?
The IUPAC name of CID 155769912 (CID 155769912) is not available.
What is the SMILES notation for CID 155769912?
The canonical SMILES for CID 155769912 is CCC(C)(C)OC(=O)N(C)c1ccc(OC[Si])cc1.
What is the InChIKey of CID 155769912?
The InChIKey is UYDJYRJXIIEEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20NO3Si/c1-5-14(2,3)18-13(16)15(4)11-6-8-12(9-7-11)17-10-19/h6-9H,5,10H2,1-4H3.
What are the key properties of CID 155769912?
CID 155769912 has a molecular weight of 278.40 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155769912 is sourced from PubChem (CID 155769912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).