C21H34N2OS — CID 155770296
N-(2,2-dimethyl-3-pyrrolidin-1-ylpropyl)-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophene-2-carboxamide (PubChem CID 155770296) has the molecular formula C21H34N2OS and a molecular weight of 362.58 g/mol. Its IUPAC name is N-(2,2-dimethyl-3-pyrrolidin-1-ylpropyl)-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophene-2-carboxamide.
| Compound Name | N-(2,2-dimethyl-3-pyrrolidin-1-ylpropyl)-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 155770296 |
| Molecular Formula | C21H34N2OS |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | N-(2,2-dimethyl-3-pyrrolidin-1-ylpropyl)-5,6,7,8,9,10-hexahydro-4H-cyclonona[b]thiophene-2-carboxamide |
| SMILES | CC(C)(CNC(=O)c1cc2c(s1)CCCCCCC2)CN1CCCC1 |
| InChI | InChI=1S/C21H34N2OS/c1-21(2,16-23-12-8-9-13-23)15-22-20(24)19-14-17-10-6-4-3-5-7-11-18(17)25-19/h14H,3-13,15-16H2,1-2H3,(H,22,24) |
| InChIKey | BSEBPLKFVYQCMU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |