C28H42O4 — CID 155770592
1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 155770592) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155770592 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 1-[6-[3-[6-(1-formyloxycyclopropyl)hexyl]-2,4-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(CCCCCCC2(C(=O)O)CC2)c(C)c1CCCCCCC1(OC=O)CC1 |
| InChI | InChI=1S/C28H42O4/c1-22-13-14-24(11-7-3-5-9-15-27(17-18-27)26(30)31)23(2)25(22)12-8-4-6-10-16-28(19-20-28)32-21-29/h13-14,21H,3-12,15-20H2,1-2H3,(H,30,31) |
| InChIKey | KEPCUIJHJLUPAI-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|