C26H16F3N2O4+ — CID 155772313
3-[(Z)-(6-formyloxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid (PubChem CID 155772313) has the molecular formula C26H16F3N2O4+ and a molecular weight of 477.42 g/mol. Its IUPAC name is 3-[(Z)-(6-formyloxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid.
| Compound Name | 3-[(Z)-(6-formyloxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 155772313 |
| Molecular Formula | C26H16F3N2O4+ |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 3-[(Z)-(6-formyloxyindol-1-ium-3-ylidene)-[4-(trifluoromethyl)phenyl]methyl]-1H-indole-6-carboxylic acid |
| SMILES | O=COc1ccc2c(c1)[NH+]=C/C2=C(/c1ccc(C(F)(F)F)cc1)c1c[nH]c2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C26H15F3N2O4/c27-26(28,29)16-4-1-14(2-5-16)24(20-11-30-22-9-15(25(33)34)3-7-18(20)22)21-12-31-23-10-17(35-13-32)6-8-19(21)23/h1-13,30H,(H,33,34)/p+1/b24-21+ |
| InChIKey | STCBDQQULHKTLE-DARPEHSRSA-O |
| XLogP | 4.18 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|