C23H28FN7O2 — CID 155772435
6-[4-[3-[[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-3-methylpyrimidin-4-one (PubChem CID 155772435) has the molecular formula C23H28FN7O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 6-[4-[3-[[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-3-methylpyrimidin-4-one.
| Compound Name | 6-[4-[3-[[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 155772435 |
| Molecular Formula | C23H28FN7O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 6-[4-[3-[[(3S)-3-fluoro-2,2,6,6-tetramethylpiperidin-4-yl]amino]-1,2,4-triazin-6-yl]-3-hydroxyphenyl]-3-methylpyrimidin-4-one |
| SMILES | Cn1cnc(-c2ccc(-c3cnc(NC4CC(C)(C)NC(C)(C)[C@H]4F)nn3)c(O)c2)cc1=O |
| InChI | InChI=1S/C23H28FN7O2/c1-22(2)10-16(20(24)23(3,4)30-22)27-21-25-11-17(28-29-21)14-7-6-13(8-18(14)32)15-9-19(33)31(5)12-26-15/h6-9,11-12,16,20,30,32H,10H2,1-5H3,(H,25,27,29)/t16?,20-/m0/s1 |
| InChIKey | IHEFZZHEXLRIEV-FZCLLLDFSA-N |
| XLogP | 2.67 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |