C27H26F3N7O3 — CID 155772578
[3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1-methylindazol-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 155772578) has the molecular formula C27H26F3N7O3 and a molecular weight of 553.55 g/mol. Its IUPAC name is [3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1-methylindazol-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1-methylindazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155772578 |
| Molecular Formula | C27H26F3N7O3 |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | [3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(1-methylindazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | CN1CCC2(CC1)CN(c1ncc(-c3c(O)cc(-c4ccc5c(cnn5C)c4)cc3OC(=O)C(F)(F)F)nn1)C2 |
| InChI | InChI=1S/C27H26F3N7O3/c1-35-7-5-26(6-8-35)14-37(15-26)25-31-13-19(33-34-25)23-21(38)10-17(11-22(23)40-24(39)27(28,29)30)16-3-4-20-18(9-16)12-32-36(20)2/h3-4,9-13,38H,5-8,14-15H2,1-2H3 |
| InChIKey | OFKCZDROMDBXHZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|