C59H45N7O2 — CID 155772894
tert-butyl N-[4-[3,5-bis[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate (PubChem CID 155772894) has the molecular formula C59H45N7O2 and a molecular weight of 884.06 g/mol. Its IUPAC name is tert-butyl N-[4-[3,5-bis[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3,5-bis[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 155772894 |
| Molecular Formula | C59H45N7O2 |
| Molecular Weight | 884.06 g/mol |
| Exact Mass | 883.36 |
| IUPAC Name | tert-butyl N-[4-[3,5-bis[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cc(-c3cccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)c3)cc(-c3cccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C59H45N7O2/c1-59(2,3)68-58(67)64-49-24-22-39(23-25-49)44-32-45(40-14-12-16-42(30-40)47-35-54(50-18-4-8-26-60-50)65-55(36-47)51-19-5-9-27-61-51)34-46(33-44)41-15-13-17-43(31-41)48-37-56(52-20-6-10-28-62-52)66-57(38-48)53-21-7-11-29-63-53/h4-38H,1-3H3,(H,64,67) |
| InChIKey | DXPSNTSEOIVFQG-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.06 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |