About tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate
tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate (PubChem CID 155772904) has the molecular formula C38H32N4O2
and a molecular weight of 576.70 g/mol. Its IUPAC name is tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate |
| PubChem CID | 155772904 |
| Molecular Formula | C38H32N4O2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cccc(-c3cccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C38H32N4O2/c1-38(2,3)44-37(43)41-32-18-16-26(17-19-32)27-10-8-11-28(22-27)29-12-9-13-30(23-29)31-24-35(33-14-4-6-20-39-33)42-36(25-31)34-15-5-7-21-40-34/h4-25H,1-3H3,(H,41,43) |
| InChIKey | GQXLEVDOLMOQQD-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate?
The IUPAC name of tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate (CID 155772904) is tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate.
What is the SMILES notation for tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate?
The canonical SMILES for tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate is CC(C)(C)OC(=O)Nc1ccc(-c2cccc(-c3cccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)c3)c2)cc1.
What is the InChIKey of tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate?
The InChIKey is GQXLEVDOLMOQQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H32N4O2/c1-38(2,3)44-37(43)41-32-18-16-26(17-19-32)27-10-8-11-28(22-27)29-12-9-13-30(23-29)31-24-35(33-14-4-6-20-39-33)42-36(25-31)34-15-5-7-21-40-34/h4-25H,1-3H3,(H,41,43).
What are the key properties of tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate?
tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate has a molecular weight of 576.70 g/mol, XLogP of 9.55, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-[3-[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]carbamate is sourced from PubChem (CID 155772904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).