C22H24N4O5 — CID 155773356
N-[[(2-aminoacetyl)amino]methyl]-2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetamide (PubChem CID 155773356) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[[(2-aminoacetyl)amino]methyl]-2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetamide.
| Compound Name | N-[[(2-aminoacetyl)amino]methyl]-2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 155773356 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[[(2-aminoacetyl)amino]methyl]-2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetamide |
| SMILES | COc1ccc(-c2noc(CC(=O)NCNC(=O)CN)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H24N4O5/c1-29-16-7-3-14(4-8-16)21-18(11-19(27)24-13-25-20(28)12-23)31-26-22(21)15-5-9-17(30-2)10-6-15/h3-10H,11-13,23H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | PHCVKHHWDILOJE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|