C17H26O4 — CID 155773640
ethyl 2-[(3S,3aR,5R,7aS)-3a-acetyl-3-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]prop-2-enoate (PubChem CID 155773640) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl 2-[(3S,3aR,5R,7aS)-3a-acetyl-3-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(3S,3aR,5R,7aS)-3a-acetyl-3-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 155773640 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethyl 2-[(3S,3aR,5R,7aS)-3a-acetyl-3-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-inden-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1CC[C@@]2(C)CC[C@H](O)[C@@]2(C(C)=O)C1 |
| InChI | InChI=1S/C17H26O4/c1-5-21-15(20)11(2)13-6-8-16(4)9-7-14(19)17(16,10-13)12(3)18/h13-14,19H,2,5-10H2,1,3-4H3/t13-,14+,16+,17+/m1/s1 |
| InChIKey | CLZBQXKBQTXXET-OHFALNGGSA-N |
| XLogP | 2.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|