C28H34F3N3O3S — CID 155773736
(1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-2-[(2R)-2-methylsulfonylpropyl]-1,3,4,5-tetrahydropyrido[3,4-b]indole (PubChem CID 155773736) has the molecular formula C28H34F3N3O3S and a molecular weight of 549.66 g/mol. Its IUPAC name is (1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-2-[(2R)-2-methylsulfonylpropyl]-1,3,4,5-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-2-[(2R)-2-methylsulfonylpropyl]-1,3,4,5-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155773736 |
| Molecular Formula | C28H34F3N3O3S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | (1R,3R)-1-[2,6-difluoro-4-[1-(3-fluoropropyl)azetidin-3-yl]oxyphenyl]-3-methyl-2-[(2R)-2-methylsulfonylpropyl]-1,3,4,5-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1CC2=C3CC=CC=C3N=C2[C@@H](c2c(F)cc(OC3CN(CCCF)C3)cc2F)N1C[C@@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C28H34F3N3O3S/c1-17-11-22-21-7-4-5-8-25(21)32-27(22)28(34(17)14-18(2)38(3,35)36)26-23(30)12-19(13-24(26)31)37-20-15-33(16-20)10-6-9-29/h4-5,8,12-13,17-18,20,28H,6-7,9-11,14-16H2,1-3H3/t17-,18-,28-/m1/s1 |
| InChIKey | DHRPEVCYPHYBPA-JAGNJQOISA-N |
| XLogP | 4.55 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |