About (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine
(1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (PubChem CID 155774152) has the molecular formula C20H26N4S
and a molecular weight of 354.52 g/mol. Its IUPAC name is (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine.
Molecular Properties
| Compound Name | (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| PubChem CID | 155774152 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine |
| SMILES | CC(C)Sc1cnc(N2CCC3(CC2)Cc2ccccc2[C@H]3N)cn1 |
| InChI | InChI=1S/C20H26N4S/c1-14(2)25-18-13-22-17(12-23-18)24-9-7-20(8-10-24)11-15-5-3-4-6-16(15)19(20)21/h3-6,12-14,19H,7-11,21H2,1-2H3/t19-/m1/s1 |
| InChIKey | SNBZRIQFKOCCTJ-LJQANCHMSA-N |
| XLogP | 3.82 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
The IUPAC name of (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine (CID 155774152) is (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine.
What is the SMILES notation for (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
The canonical SMILES for (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine is CC(C)Sc1cnc(N2CCC3(CC2)Cc2ccccc2[C@H]3N)cn1.
What is the InChIKey of (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
The InChIKey is SNBZRIQFKOCCTJ-LJQANCHMSA-N. The full InChI is InChI=1S/C20H26N4S/c1-14(2)25-18-13-22-17(12-23-18)24-9-7-20(8-10-24)11-15-5-3-4-6-16(15)19(20)21/h3-6,12-14,19H,7-11,21H2,1-2H3/t19-/m1/s1.
What are the key properties of (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine?
(1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine has a molecular weight of 354.52 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1'-(5-propan-2-ylsulfanylpyrazin-2-yl)spiro[1,3-dihydroindene-2,4'-piperidine]-1-amine is sourced from PubChem (CID 155774152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).