C36H44N8O4 — CID 155774388
tert-butyl N-[(3R)-1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-3-yl]carbamate (PubChem CID 155774388) has the molecular formula C36H44N8O4 and a molecular weight of 652.80 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-3-yl]carbamate |
|---|---|
| PubChem CID | 155774388 |
| Molecular Formula | C36H44N8O4 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | tert-butyl N-[(3R)-1'-[3-(3,4-dihydro-2H-1,5-naphthyridin-1-yl)-5-methyl-1-(oxan-2-yl)pyrazolo[3,4-b]pyrazin-6-yl]spiro[3H-1-benzofuran-2,4'-piperidine]-3-yl]carbamate |
| SMILES | Cc1nc2c(N3CCCc4ncccc43)nn(C3CCCCO3)c2nc1N1CCC2(CC1)Oc1ccccc1[C@H]2NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H44N8O4/c1-23-31(42-20-16-36(17-21-42)30(39-34(45)48-35(2,3)4)24-11-5-6-14-27(24)47-36)40-32-29(38-23)33(41-44(32)28-15-7-8-22-46-28)43-19-10-12-25-26(43)13-9-18-37-25/h5-6,9,11,13-14,18,28,30H,7-8,10,12,15-17,19-22H2,1-4H3,(H,39,45)/t28?,30-/m1/s1 |
| InChIKey | UYMMMXOVCRQBFK-FUJFQHJFSA-N |
| XLogP | 6.31 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |