C14H19N3OS — CID 155775143
3-(3-hydroxypropyl)-4-(3,4,5-trimethylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 155775143) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-4-(3,4,5-trimethylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-hydroxypropyl)-4-(3,4,5-trimethylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 155775143 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-(3-hydroxypropyl)-4-(3,4,5-trimethylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(-n2c(CCCO)n[nH]c2=S)cc(C)c1C |
| InChI | InChI=1S/C14H19N3OS/c1-9-7-12(8-10(2)11(9)3)17-13(5-4-6-18)15-16-14(17)19/h7-8,18H,4-6H2,1-3H3,(H,16,19) |
| InChIKey | ULKPRWDUJDCWTR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|