C15H15F4NO3S — CID 155776868
5,5-dimethyl-3-[(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenoxy)methylsulfanyl]-4H-1,2-oxazole (PubChem CID 155776868) has the molecular formula C15H15F4NO3S and a molecular weight of 365.35 g/mol. Its IUPAC name is 5,5-dimethyl-3-[(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenoxy)methylsulfanyl]-4H-1,2-oxazole.
| Compound Name | 5,5-dimethyl-3-[(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenoxy)methylsulfanyl]-4H-1,2-oxazole |
|---|---|
| PubChem CID | 155776868 |
| Molecular Formula | C15H15F4NO3S |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 5,5-dimethyl-3-[(2,3,5,6-tetrafluoro-4-prop-2-enoxyphenoxy)methylsulfanyl]-4H-1,2-oxazole |
| SMILES | C=CCOc1c(F)c(F)c(OCSC2=NOC(C)(C)C2)c(F)c1F |
| InChI | InChI=1S/C15H15F4NO3S/c1-4-5-21-13-9(16)11(18)14(12(19)10(13)17)22-7-24-8-6-15(2,3)23-20-8/h4H,1,5-7H2,2-3H3 |
| InChIKey | OOCSWFJVYNMMAO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|