C30H34BN3O6S — CID 155777225
4-methyl-8-[1-[1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 155777225) has the molecular formula C30H34BN3O6S and a molecular weight of 575.50 g/mol. Its IUPAC name is 4-methyl-8-[1-[1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-methyl-8-[1-[1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 155777225 |
| Molecular Formula | C30H34BN3O6S |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 4-methyl-8-[1-[1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-yl]sulfonylpyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | CN1CCOc2cc(-c3cn(S(=O)(=O)C4(C)C=C(B5OC(C)(C)C(C)(C)O5)C=CC4)c4ncccc34)ccc2C1=O |
| InChI | InChI=1S/C30H34BN3O6S/c1-28(2)29(3,4)40-31(39-28)21-9-7-13-30(5,18-21)41(36,37)34-19-24(22-10-8-14-32-26(22)34)20-11-12-23-25(17-20)38-16-15-33(6)27(23)35/h7-12,14,17-19H,13,15-16H2,1-6H3 |
| InChIKey | NQKAQCDRQBMDJV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|