C36H49N7O5 — CID 155777732
tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-(butylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 155777732) has the molecular formula C36H49N7O5 and a molecular weight of 659.83 g/mol. Its IUPAC name is tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-(butylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-(butylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155777732 |
| Molecular Formula | C36H49N7O5 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-(butylamino)imidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | CCCCNc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)C3CCN(C(=O)OC(C)(C)C)CC3)n2n1 |
| InChI | InChI=1S/C36H49N7O5/c1-7-8-19-37-34-39-33(42(23-25-9-13-28(46-5)14-10-25)24-26-11-15-29(47-6)16-12-26)32-38-22-30(43(32)40-34)31(44)27-17-20-41(21-18-27)35(45)48-36(2,3)4/h9-16,22,27,31,44H,7-8,17-21,23-24H2,1-6H3,(H,37,40) |
| InChIKey | GMIZVJLEFWUFPJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|