C37H48F2N6O6 — CID 155777793
tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-[(2S)-pentan-2-yl]oxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3,3-difluoropiperidine-1-carboxylate (PubChem CID 155777793) has the molecular formula C37H48F2N6O6 and a molecular weight of 710.82 g/mol. Its IUPAC name is tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-[(2S)-pentan-2-yl]oxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3,3-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-[(2S)-pentan-2-yl]oxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3,3-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155777793 |
| Molecular Formula | C37H48F2N6O6 |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | tert-butyl 4-[[4-[bis[(4-methoxyphenyl)methyl]amino]-2-[(2S)-pentan-2-yl]oxyimidazo[2,1-f][1,2,4]triazin-7-yl]-hydroxymethyl]-3,3-difluoropiperidine-1-carboxylate |
| SMILES | CCC[C@H](C)Oc1nc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c2ncc(C(O)C3CCN(C(=O)OC(C)(C)C)CC3(F)F)n2n1 |
| InChI | InChI=1S/C37H48F2N6O6/c1-8-9-24(2)50-34-41-33(44(21-25-10-14-27(48-6)15-11-25)22-26-12-16-28(49-7)17-13-26)32-40-20-30(45(32)42-34)31(46)29-18-19-43(23-37(29,38)39)35(47)51-36(3,4)5/h10-17,20,24,29,31,46H,8-9,18-19,21-23H2,1-7H3/t24-,29?,31?/m0/s1 |
| InChIKey | YXIFPCOVLDWMDI-KKUDVBHYSA-N |
| XLogP | 6.84 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |