C7H12O2 — CID 15577854
1-methylcyclohex-4-ene-1,2-diol (PubChem CID 15577854) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 1-methylcyclohex-4-ene-1,2-diol.
| Compound Name | 1-methylcyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 15577854 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 1-methylcyclohex-4-ene-1,2-diol |
| SMILES | CC1(O)CC=CCC1O |
| InChI | InChI=1S/C7H12O2/c1-7(9)5-3-2-4-6(7)8/h2-3,6,8-9H,4-5H2,1H3 |
| InChIKey | AAYHRAKNHMDNGG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|