About 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine
3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine (PubChem CID 155780047) has the molecular formula C18H14N6
and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine |
| PubChem CID | 155780047 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine |
| SMILES | c1cnc(-c2ncc([C@H]3C[C@H]3c3cnc4ccccn34)cn2)nc1 |
| InChI | InChI=1S/C18H14N6/c1-2-7-24-15(11-21-16(24)4-1)14-8-13(14)12-9-22-18(23-10-12)17-19-5-3-6-20-17/h1-7,9-11,13-14H,8H2/t13-,14-/m1/s1 |
| InChIKey | QPTMOHRCHHZDNB-ZIAGYGMSSA-N |
| XLogP | 2.85 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine?
The IUPAC name of 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine (CID 155780047) is 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine is c1cnc(-c2ncc([C@H]3C[C@H]3c3cnc4ccccn34)cn2)nc1.
What is the InChIKey of 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine?
The InChIKey is QPTMOHRCHHZDNB-ZIAGYGMSSA-N. The full InChI is InChI=1S/C18H14N6/c1-2-7-24-15(11-21-16(24)4-1)14-8-13(14)12-9-22-18(23-10-12)17-19-5-3-6-20-17/h1-7,9-11,13-14H,8H2/t13-,14-/m1/s1.
What are the key properties of 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine?
3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine has a molecular weight of 314.35 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2S)-2-(2-pyrimidin-2-ylpyrimidin-5-yl)cyclopropyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 155780047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).