About (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione
(4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione (PubChem CID 155782215) has the molecular formula C10H19NOS2
and a molecular weight of 233.40 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione |
| PubChem CID | 155782215 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione |
| SMILES | CC[C@H](O)N1C(=S)SC[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C10H19NOS2/c1-5-8(12)11-7(10(2,3)4)6-14-9(11)13/h7-8,12H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | KDQNKOBTLINOGR-SFYZADRCSA-N |
| XLogP | 2.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione?
The IUPAC name of (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione (CID 155782215) is (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione.
What is the SMILES notation for (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione?
The canonical SMILES for (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione is CC[C@H](O)N1C(=S)SC[C@@H]1C(C)(C)C.
What is the InChIKey of (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione?
The InChIKey is KDQNKOBTLINOGR-SFYZADRCSA-N. The full InChI is InChI=1S/C10H19NOS2/c1-5-8(12)11-7(10(2,3)4)6-14-9(11)13/h7-8,12H,5-6H2,1-4H3/t7-,8+/m1/s1.
What are the key properties of (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione?
(4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione has a molecular weight of 233.40 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-tert-butyl-3-[(1S)-1-hydroxypropyl]-1,3-thiazolidine-2-thione is sourced from PubChem (CID 155782215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).