C11H8F3NO3 — CID 15578243
(2-isocyanato-1-phenylethyl) 2,2,2-trifluoroacetate (PubChem CID 15578243) has the molecular formula C11H8F3NO3 and a molecular weight of 259.18 g/mol. Its IUPAC name is (2-isocyanato-1-phenylethyl) 2,2,2-trifluoroacetate.
| Compound Name | (2-isocyanato-1-phenylethyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 15578243 |
| Molecular Formula | C11H8F3NO3 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (2-isocyanato-1-phenylethyl) 2,2,2-trifluoroacetate |
| SMILES | O=C=NCC(OC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H8F3NO3/c12-11(13,14)10(17)18-9(6-15-7-16)8-4-2-1-3-5-8/h1-5,9H,6H2 |
| InChIKey | VGLRBISRPWAKBQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|