C21H19F2N7OS — CID 155782779
N-[1-cyclohexyl-3-(3,6-difluoro-2-pyridinyl)pyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 155782779) has the molecular formula C21H19F2N7OS and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-(3,6-difluoro-2-pyridinyl)pyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[1-cyclohexyl-3-(3,6-difluoro-2-pyridinyl)pyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155782779 |
| Molecular Formula | C21H19F2N7OS |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[1-cyclohexyl-3-(3,6-difluoro-2-pyridinyl)pyrazol-4-yl]-2-(1H-pyrazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cn(C2CCCCC2)nc1-c1nc(F)ccc1F)c1csc(-c2cn[nH]c2)n1 |
| InChI | InChI=1S/C21H19F2N7OS/c22-14-6-7-17(23)28-18(14)19-15(10-30(29-19)13-4-2-1-3-5-13)26-20(31)16-11-32-21(27-16)12-8-24-25-9-12/h6-11,13H,1-5H2,(H,24,25)(H,26,31) |
| InChIKey | JMEVVNBTPHXPSR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|