C29H35F2N7O6PS+ — CID 155782841
tert-butyl 1-[4-[4-[[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexylidene)pyrazol-1-ium-4-yl]carbamoyl]-1,3-thiazol-2-yl]pyrazol-1-yl]ethyl hydrogen phosphate (PubChem CID 155782841) has the molecular formula C29H35F2N7O6PS+ and a molecular weight of 678.68 g/mol. Its IUPAC name is tert-butyl 1-[4-[4-[[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexylidene)pyrazol-1-ium-4-yl]carbamoyl]-1,3-thiazol-2-yl]pyrazol-1-yl]ethyl hydrogen phosphate.
| Compound Name | tert-butyl 1-[4-[4-[[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexylidene)pyrazol-1-ium-4-yl]carbamoyl]-1,3-thiazol-2-yl]pyrazol-1-yl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 155782841 |
| Molecular Formula | C29H35F2N7O6PS+ |
| Molecular Weight | 678.68 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | tert-butyl 1-[4-[4-[[3-(3,6-difluoro-2-pyridinyl)-1-(4-ethoxycyclohexylidene)pyrazol-1-ium-4-yl]carbamoyl]-1,3-thiazol-2-yl]pyrazol-1-yl]ethyl hydrogen phosphate |
| SMILES | CCOC1CCC(=[N+]2C=C(NC(=O)c3csc(-c4cnn(C(C)OP(=O)(O)OC(C)(C)C)c4)n3)C(c3nc(F)ccc3F)=N2)CC1 |
| InChI | InChI=1S/C29H34F2N7O6PS/c1-6-42-20-9-7-19(8-10-20)38-15-22(26(36-38)25-21(30)11-12-24(31)35-25)33-27(39)23-16-46-28(34-23)18-13-32-37(14-18)17(2)43-45(40,41)44-29(3,4)5/h11-17,20H,6-10H2,1-5H3,(H-,33,39,40,41)/p+1/b38-19- |
| InChIKey | HBMPIJOCOZHURP-GZOMZLSJSA-O |
| XLogP | 5.55 |
| TPSA | 153.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|