C17H18N2O2S — CID 155784024
methyl 5-methyl-2-[(E)-(1-phenylpyrrolidin-2-ylidene)amino]thiophene-3-carboxylate (PubChem CID 155784024) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is methyl 5-methyl-2-[(E)-(1-phenylpyrrolidin-2-ylidene)amino]thiophene-3-carboxylate.
| Compound Name | methyl 5-methyl-2-[(E)-(1-phenylpyrrolidin-2-ylidene)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 155784024 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl 5-methyl-2-[(E)-(1-phenylpyrrolidin-2-ylidene)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1cc(C)sc1/N=C1\CCCN1c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2S/c1-12-11-14(17(20)21-2)16(22-12)18-15-9-6-10-19(15)13-7-4-3-5-8-13/h3-5,7-8,11H,6,9-10H2,1-2H3/b18-15+ |
| InChIKey | FOILDMYIWMBZPX-OBGWFSINSA-N |
| XLogP | 4.17 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|