C21H32ClN5O3SSi — CID 155784187
6-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]-5-trimethylsilylpyridine-3-carboxamide (PubChem CID 155784187) has the molecular formula C21H32ClN5O3SSi and a molecular weight of 498.13 g/mol. Its IUPAC name is 6-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]-5-trimethylsilylpyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]-5-trimethylsilylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155784187 |
| Molecular Formula | C21H32ClN5O3SSi |
| Molecular Weight | 498.13 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 6-chloro-N-(1,3-dimethylpyrazol-4-yl)sulfonyl-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]-5-trimethylsilylpyridine-3-carboxamide |
| SMILES | Cc1nn(C)cc1S(=O)(=O)NC(=O)c1cc([Si](C)(C)C)c(Cl)nc1N1C[C@@H](C)CC1(C)C |
| InChI | InChI=1S/C21H32ClN5O3SSi/c1-13-10-21(3,4)27(11-13)19-15(9-17(18(22)23-19)32(6,7)8)20(28)25-31(29,30)16-12-26(5)24-14(16)2/h9,12-13H,10-11H2,1-8H3,(H,25,28)/t13-/m0/s1 |
| InChIKey | BPHYFCWVPMGNDU-ZDUSSCGKSA-N |
| XLogP | 3.07 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|