C14H17I3NO2+ — CID 155784594
(1-methylpiperidin-1-ium-4-yl)methyl 2,3,5-triiodobenzoate (PubChem CID 155784594) has the molecular formula C14H17I3NO2+ and a molecular weight of 612.01 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-4-yl)methyl 2,3,5-triiodobenzoate.
| Compound Name | (1-methylpiperidin-1-ium-4-yl)methyl 2,3,5-triiodobenzoate |
|---|---|
| PubChem CID | 155784594 |
| Molecular Formula | C14H17I3NO2+ |
| Molecular Weight | 612.01 g/mol |
| Exact Mass | 611.84 |
| IUPAC Name | (1-methylpiperidin-1-ium-4-yl)methyl 2,3,5-triiodobenzoate |
| SMILES | C[NH+]1CCC(COC(=O)c2cc(I)cc(I)c2I)CC1 |
| InChI | InChI=1S/C14H16I3NO2/c1-18-4-2-9(3-5-18)8-20-14(19)11-6-10(15)7-12(16)13(11)17/h6-7,9H,2-5,8H2,1H3/p+1 |
| InChIKey | MUBWZYCJFGUUPY-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.01 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|