About 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene
4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene (PubChem CID 155785036) has the molecular formula C16H24
and a molecular weight of 220.39 g/mol. Its IUPAC name is 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene.
Molecular Properties
| Compound Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene |
| PubChem CID | 155785036 |
| Molecular Formula | C16H24 |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 220.21 |
| IUPAC Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene |
| SMILES | [2H]C([2H])([2H])c1cc(C2([2H])CCC(C)(C)CC2)ccc1C |
| InChI | InChI=1S/C16H24/c1-12-5-6-15(11-13(12)2)14-7-9-16(3,4)10-8-14/h5-6,11,14H,7-10H2,1-4H3/i2D3,14D |
| InChIKey | HMMNEBZFTBGEQH-JACJUQRUSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene?
The IUPAC name of 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene (CID 155785036) is 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene.
What is the SMILES notation for 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene?
The canonical SMILES for 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene is [2H]C([2H])([2H])c1cc(C2([2H])CCC(C)(C)CC2)ccc1C.
What is the InChIKey of 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene?
The InChIKey is HMMNEBZFTBGEQH-JACJUQRUSA-N. The full InChI is InChI=1S/C16H24/c1-12-5-6-15(11-13(12)2)14-7-9-16(3,4)10-8-14/h5-6,11,14H,7-10H2,1-4H3/i2D3,14D.
What are the key properties of 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene?
4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene has a molecular weight of 220.39 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-deuterio-4,4-dimethylcyclohexyl)-1-methyl-2-(trideuteriomethyl)benzene is sourced from PubChem (CID 155785036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).