C41H31N3Si — CID 155787127
2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-8-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine (PubChem CID 155787127) has the molecular formula C41H31N3Si and a molecular weight of 593.81 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-8-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-8-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155787127 |
| Molecular Formula | C41H31N3Si |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 2-(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-8-yl)-4-phenyl-6-(3-phenylphenyl)-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccccc5)c4)n3)cc2-c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C41H31N3Si/c1-45(2)37-24-22-34(26-36(37)35-23-21-32(27-38(35)45)29-15-8-4-9-16-29)41-43-39(30-17-10-5-11-18-30)42-40(44-41)33-20-12-19-31(25-33)28-13-6-3-7-14-28/h3-27H,1-2H3 |
| InChIKey | JVMMVWWZMMIHEZ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|