About N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium
N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium (PubChem CID 155787460) has the molecular formula C15H19N3O3Y-2
and a molecular weight of 378.24 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium.
Molecular Properties
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium |
| PubChem CID | 155787460 |
| Molecular Formula | C15H19N3O3Y-2 |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium |
| SMILES | C[C-](C)C.O=C1CCC(NC(=O)c2ccc[c-]n2)C(=O)N1.[Y] |
| InChI | InChI=1S/C11H10N3O3.C4H9.Y/c15-9-5-4-8(11(17)14-9)13-10(16)7-3-1-2-6-12-7;1-4(2)3;/h1-3,8H,4-5H2,(H,13,16)(H,14,15,17);1-3H3;/q2*-1; |
| InChIKey | IFCSLJSRIVRFNZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium?
The IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium (CID 155787460) is N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium.
What is the SMILES notation for N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium?
The canonical SMILES for N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium is C[C-](C)C.O=C1CCC(NC(=O)c2ccc[c-]n2)C(=O)N1.[Y].
What is the InChIKey of N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium?
The InChIKey is IFCSLJSRIVRFNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N3O3.C4H9.Y/c15-9-5-4-8(11(17)14-9)13-10(16)7-3-1-2-6-12-7;1-4(2)3;/h1-3,8H,4-5H2,(H,13,16)(H,14,15,17);1-3H3;/q2*-1;.
What are the key properties of N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium?
N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium has a molecular weight of 378.24 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dioxopiperidin-3-yl)-2H-pyridin-2-ide-6-carboxamide;2-methylpropane;yttrium is sourced from PubChem (CID 155787460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).