About 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid
2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid (PubChem CID 155789620) has the molecular formula C12H11ClFN3O2
and a molecular weight of 283.69 g/mol. Its IUPAC name is 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid |
| PubChem CID | 155789620 |
| Molecular Formula | C12H11ClFN3O2 |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid |
| SMILES | CCn1nc(-c2ccc(Cl)c(F)c2)nc1CC(=O)O |
| InChI | InChI=1S/C12H11ClFN3O2/c1-2-17-10(6-11(18)19)15-12(16-17)7-3-4-8(13)9(14)5-7/h3-5H,2,6H2,1H3,(H,18,19) |
| InChIKey | MNWLUHFHWDJGRA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid (CID 155789620) is 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid is CCn1nc(-c2ccc(Cl)c(F)c2)nc1CC(=O)O.
What is the InChIKey of 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid?
The InChIKey is MNWLUHFHWDJGRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClFN3O2/c1-2-17-10(6-11(18)19)15-12(16-17)7-3-4-8(13)9(14)5-7/h3-5H,2,6H2,1H3,(H,18,19).
What are the key properties of 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid?
2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid has a molecular weight of 283.69 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-chloro-3-fluorophenyl)-2-ethyl-1,2,4-triazol-3-yl]acetic acid is sourced from PubChem (CID 155789620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).