About 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol
4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol (PubChem CID 155789701) has the molecular formula C20H28O7P2
and a molecular weight of 442.39 g/mol. Its IUPAC name is 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol.
Molecular Properties
| Compound Name | 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol |
| PubChem CID | 155789701 |
| Molecular Formula | C20H28O7P2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol |
| SMILES | COP(=O)(CCc1cc(CCP(=O)(OC)OC)cc(-c2ccc(O)cc2)c1)OC |
| InChI | InChI=1S/C20H28O7P2/c1-24-28(22,25-2)11-9-16-13-17(10-12-29(23,26-3)27-4)15-19(14-16)18-5-7-20(21)8-6-18/h5-8,13-15,21H,9-12H2,1-4H3 |
| InChIKey | JSWFMMOSQCAOAA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol?
The IUPAC name of 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol (CID 155789701) is 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol.
What is the SMILES notation for 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol?
The canonical SMILES for 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol is COP(=O)(CCc1cc(CCP(=O)(OC)OC)cc(-c2ccc(O)cc2)c1)OC.
What is the InChIKey of 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol?
The InChIKey is JSWFMMOSQCAOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28O7P2/c1-24-28(22,25-2)11-9-16-13-17(10-12-29(23,26-3)27-4)15-19(14-16)18-5-7-20(21)8-6-18/h5-8,13-15,21H,9-12H2,1-4H3.
What are the key properties of 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol?
4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol has a molecular weight of 442.39 g/mol, XLogP of 5.12, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-bis(2-dimethoxyphosphorylethyl)phenyl]phenol is sourced from PubChem (CID 155789701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).