C29H41N3O2 — CID 155789792
[(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol (PubChem CID 155789792) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol.
| Compound Name | [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol |
|---|---|
| PubChem CID | 155789792 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | [(5R,6S)-5-[(3aS,4R,5S,7aS)-4-(aminomethyl)-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-2-[(4-methoxyphenyl)methyl]-5-methyl-6,7-dihydro-4H-indazol-6-yl]methanol |
| SMILES | C=C1CC[C@H]2[C@H](CN)[C@@H]([C@@]3(C)Cc4cn(Cc5ccc(OC)cc5)nc4C[C@@H]3CO)CC[C@]12C |
| InChI | InChI=1S/C29H41N3O2/c1-19-5-10-25-24(15-30)26(11-12-28(19,25)2)29(3)14-21-17-32(31-27(21)13-22(29)18-33)16-20-6-8-23(34-4)9-7-20/h6-9,17,22,24-26,33H,1,5,10-16,18,30H2,2-4H3/t22-,24+,25+,26+,28-,29+/m1/s1 |
| InChIKey | PCWKCCNIEUPFLA-FMRAKGTRSA-N |
| XLogP | 4.61 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|