C23H28ClN3O2 — CID 155789815
(1S,2R,10S,11R,12R,13R,14S,22S)-19-chloro-2,22-dimethyl-6,7,20-triazahexacyclo[11.11.0.02,10.04,8.014,22.016,21]tetracosa-4(8),5,16(21),17,19-pentaene-11,12-diol (PubChem CID 155789815) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is (1S,2R,10S,11R,12R,13R,14S,22S)-19-chloro-2,22-dimethyl-6,7,20-triazahexacyclo[11.11.0.02,10.04,8.014,22.016,21]tetracosa-4(8),5,16(21),17,19-pentaene-11,12-diol.
| Compound Name | (1S,2R,10S,11R,12R,13R,14S,22S)-19-chloro-2,22-dimethyl-6,7,20-triazahexacyclo[11.11.0.02,10.04,8.014,22.016,21]tetracosa-4(8),5,16(21),17,19-pentaene-11,12-diol |
|---|---|
| PubChem CID | 155789815 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (1S,2R,10S,11R,12R,13R,14S,22S)-19-chloro-2,22-dimethyl-6,7,20-triazahexacyclo[11.11.0.02,10.04,8.014,22.016,21]tetracosa-4(8),5,16(21),17,19-pentaene-11,12-diol |
| SMILES | C[C@]12Cc3cn[nH]c3C[C@@H]1[C@@H](O)[C@H](O)[C@@H]1[C@@H]2CC[C@]2(C)c3nc(Cl)ccc3C[C@@H]12 |
| InChI | InChI=1S/C23H28ClN3O2/c1-22-6-5-13-18(14(22)7-11-3-4-17(24)26-21(11)22)20(29)19(28)15-8-16-12(10-25-27-16)9-23(13,15)2/h3-4,10,13-15,18-20,28-29H,5-9H2,1-2H3,(H,25,27)/t13-,14-,15+,18+,19+,20+,22-,23+/m0/s1 |
| InChIKey | GFQVJNMAMQSRGF-XDLDLJHQSA-N |
| XLogP | 3.07 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|